This quiz is in TEST MODE.
If you find any mistakes take a picture and send it to me.

Draw the structure:

CH3CH2CH(CH2CH3)CH(CH3)CH2CH3